HATU – Reagent Used in Peptide Coupling
Purchase HATU; 148893-10-1
View Safety Data Sheet (SDS)
Hazardous Packaging Fees Apply
| 25g | $80.00 |
| 100g | $240.00 |
| 250g | $480.00 |
Hexafluorophosphate Azabenzotriazole Tetramethyl Uronium (HATU) is a reagent used in peptide coupling. You can purchase this chemical in three catalog sizes: 25g, 100g or 250g, but also good for bulk quantity. HATU is a key chemical used to form a coupling reaction, creating a formation as part of peptide synthesis. See prices below.
| Catalog Number | RC8110 |
| Chemical Structure | |
| InChIKey | JNWBBCNCSMBKNE-UHFFFAOYSA-N |
| Has Part(s) | oxygen |
| Has Part(s) | carbon |
| SureChEMBL ID | 63612 |
| SureChEMBL ID | 65292 |
| EC Number | 436-160-7 |
| DSSTox Substance ID | DTXSID30933498 |
| Chemical Formula | C₁₀H₁₅F₆N₆OP |
| InChI | InChI=1S/C10H15N6O.F6P/c1-14(2)10(15(3)4)17-16-9-8(12-13-16)6-5-7-11-9;1-7(2,3,4,5)6/h5-7H,1-4H3;/q+1;-1 |
| CAS Registry Number | 148893-10-1 |
| Has Part(s) | nitrogen |
| Subclass Of | chemical compound |
| Microsoft Academic ID (discontinued) | 2780489504 |
| Freebase ID | /m/0j66h6v |
| UNII | B93RIH1T7E |
| Has Part(s) | phosphorus |
| Has Part(s) | fluorine |
| Canonical SMILES | CN(C)C(=[N+](C)C)ON1C2=C(C=CC=N2)N=N1.F[P-](F)(F)(F)(F)F |
| ChemSpider ID | 8061830 |
| DSSTox Substance ID | DTXSID201026946 |
| DSSTOX Compound Identifier | DTXCID801003174 |
| PubChem CID | 9886157 |
| Instance Of | type of chemical entity |
| Mass | 380.094915 |
| ECHA Substance Infocard ID | 100.103.434 |
| UniChem Compound ID | 22695764 |
| Commons Category | HATU |
| Has Part(s) | hydrogen |
HATU – Reagent Used in Peptide Coupling