Fmoc-Ser(But)-OH
Purchase Fmoc-Ser(But)-OH; Fmoc-O-tert-butyl-L-serine; 71989-33-8
View Safety Data Sheet (SDS)
| 5g | $30.00 |
| 25g | $50.00 |
| 100g | $150.00 |
| Catalog Number | FS2476 |
| Canonical SMILES | CC(C)(C)OCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| CAS Registry Number | 71989-33-8 |
| DSSTox Substance ID | DTXSID601231254 |
| Isomeric SMILES | CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| Mass | 383.17327290000003 |
| Instance Of | type of chemical entity |
| InChIKey | REITVGIIZHFVGU-IBGZPJMESA-N |
| SureChEMBL ID | 119575 |
| Subclass Of | chemical compound |
| PubChem CID | 2724633 |
| UNII | ZK6MDK63M3 |
| Chemical Formula | C₂₂H₂₅NO₅ |
| InChI | InChI=1S/C22H25NO5/c1-22(2,3)28-13-19(20(24)25)23-21(26)27-12-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h4-11,18-19H,12-13H2,1-3H3,(H,23,26)(H,24,25)/t19-/m0/s1 |
| UniChem Compound ID | 23651872 |
Fmoc-Ser(But)-OH
Fmoc-Ser(But)-OH Related Compounds with Annotation
Fmoc-Ser(But)-OH Depositor-Supplied Synonyms
Fmoc-Ser(But)-OH R3D Conformer
Fmoc-Ser(But)-OH GHS Classification
Buy Fmoc-Ser(But)-OH; Fmoc-O-tert-butyl-L-serine; 71989-33-8 online.