HBTU – Aminium-based Coupling Reagent for Peptide Synthesis
Purchase HBTU; 94790-37-1
View Safety Data Sheet (SDS)
| 25g | $50.00 |
| 100g | $115.00 |
| 500g | $350.00 |
| 1000g | $495.00 |
HBTU would be the most employed aminium-based coupling reagent in peptide synthesis due to its low cost, excellent activation, racemization suppression, and good solubility and stability. HBTU normally is used in combination with a base like diisopropylethyl amine. See prices below.
| Catalog Number | RC8106 |
| Chemical Structure |  |
| ECHA Substance Infocard ID | 100.133.815 |
| DSSTOX Compound Identifier | DTXCID301344280 |
| PubChem CID | 2733084 |
| UNII | X5I03TZQ8D |
| Has Part(s) | hydrogen |
| CAS Registry Number | 94790-37-1 |
| ChemSpider ID | 2014894 |
| Instance Of | type of chemical entity |
| Has Part(s) | carbon |
| Has Part(s) | oxygen |
| InChIKey | UQYZFNUUOSSNKT-UHFFFAOYSA-N |
| EC Number | 619-076-7 |
| UniChem Compound ID | 24649393 |
| Commons Category | HBTU |
| Has Part(s) | fluorine |
| Quora Topic ID | Hbtu-1 |
| Canonical SMILES | CN(C)C(=[N+](C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
| Subclass Of | chemical compound |
| Has Part(s) | phosphorus |
| DSSTox Substance ID | DTXSID101335774 |
| DSSTox Substance ID | DTXSID00915302 |
| Mass | 379.099666 |
| InChI | InChI=1S/C11H16N5O.F6P/c1-14(2)11(15(3)4)17-16-10-8-6-5-7-9(10)12-13-16;1-7(2,3,4,5)6/h5-8H,1-4H3;/q+1;-1 |
| SureChEMBL ID | 5600925 |
| Chemical Formula | C₁₁H₁₆F₆N₅OP |
| SureChEMBL ID | 66487 |
| Freebase ID | /m/0131jf_6 |
| Has Part(s) | nitrogen |
HBTU – Aminium-based Coupling Reagent for Peptide Synthesis
